C16H25NO2 — CID 98113240
morpholin-4-yl-[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methanone (PubChem CID 98113240) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is morpholin-4-yl-[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methanone.
| Compound Name | morpholin-4-yl-[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methanone |
|---|---|
| PubChem CID | 98113240 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | morpholin-4-yl-[(1S,8S)-3-tricyclo[4.3.1.13,8]undecanyl]methanone |
| SMILES | O=C(N1CCOCC1)C12CCC3C[C@@H](C[C@H](C3)C1)C2 |
| InChI | InChI=1S/C16H25NO2/c18-15(17-3-5-19-6-4-17)16-2-1-12-7-13(10-16)9-14(8-12)11-16/h12-14H,1-11H2/t12?,13-,14-,16?/m0/s1 |
| InChIKey | CNZMPJKXHVCMIY-WJEHIRDRSA-N |
| XLogP | 2.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |