C15H23NO2 — CID 110739642
1-adamantyl(1,3-oxazinan-3-yl)methanone (PubChem CID 110739642) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-adamantyl(1,3-oxazinan-3-yl)methanone.
| Compound Name | 1-adamantyl(1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 110739642 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-adamantyl(1,3-oxazinan-3-yl)methanone |
| SMILES | O=C(N1CCCOC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H23NO2/c17-14(16-2-1-3-18-10-16)15-7-11-4-12(8-15)6-13(5-11)9-15/h11-13H,1-10H2 |
| InChIKey | PXDSOKHOWROWJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |