C11H20N2O3 — CID 139559066
1,3-dimorpholin-4-ylpropan-2-one (PubChem CID 139559066) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,3-dimorpholin-4-ylpropan-2-one.
| Compound Name | 1,3-dimorpholin-4-ylpropan-2-one |
|---|---|
| PubChem CID | 139559066 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1,3-dimorpholin-4-ylpropan-2-one |
| SMILES | O=C(CN1CCOCC1)CN1CCOCC1 |
| InChI | InChI=1S/C11H20N2O3/c14-11(9-12-1-5-15-6-2-12)10-13-3-7-16-8-4-13/h1-10H2 |
| InChIKey | BDBYNGAUNVSELQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |