C13H15Cl2NO2 — CID 67707252
1-(3,4-dichlorophenyl)-3-morpholin-4-ylpropan-2-one (PubChem CID 67707252) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-morpholin-4-ylpropan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-morpholin-4-ylpropan-2-one |
|---|---|
| PubChem CID | 67707252 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-morpholin-4-ylpropan-2-one |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)CN1CCOCC1 |
| InChI | InChI=1S/C13H15Cl2NO2/c14-12-2-1-10(8-13(12)15)7-11(17)9-16-3-5-18-6-4-16/h1-2,8H,3-7,9H2 |
| InChIKey | OZFUMNQCKXYCKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |