C12H14Cl2N2O2 — CID 164862221
N-[1-(3,4-dichlorophenyl)-2-morpholin-4-ylethylidene]hydroxylamine (PubChem CID 164862221) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)-2-morpholin-4-ylethylidene]hydroxylamine.
| Compound Name | N-[1-(3,4-dichlorophenyl)-2-morpholin-4-ylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 164862221 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)-2-morpholin-4-ylethylidene]hydroxylamine |
| SMILES | ON=C(CN1CCOCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c13-10-2-1-9(7-11(10)14)12(15-17)8-16-3-5-18-6-4-16/h1-2,7,17H,3-6,8H2 |
| InChIKey | XVCGPALWBADZCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|