C15H18Cl2N2O3S — CID 88823239
2-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylsulfanyl)-2-oxoacetamide (PubChem CID 88823239) has the molecular formula C15H18Cl2N2O3S and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylsulfanyl)-2-oxoacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylsulfanyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 88823239 |
| Molecular Formula | C15H18Cl2N2O3S |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(3-morpholin-4-ylpropylsulfanyl)-2-oxoacetamide |
| SMILES | O=C(NSCCCN1CCOCC1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2O3S/c16-12-3-2-11(10-13(12)17)14(20)15(21)18-23-9-1-4-19-5-7-22-8-6-19/h2-3,10H,1,4-9H2,(H,18,21) |
| InChIKey | VUEHRNMQGIIYRB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|