C19H29Cl2N5O2 — CID 110971701
3,4-dichloro-N-[2-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 110971701) has the molecular formula C19H29Cl2N5O2 and a molecular weight of 430.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 110971701 |
| Molecular Formula | C19H29Cl2N5O2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCCN1CCOCC1)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H29Cl2N5O2/c1-2-22-19(24-6-3-9-26-10-12-28-13-11-26)25-8-7-23-18(27)15-4-5-16(20)17(21)14-15/h4-5,14H,2-3,6-13H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | MQKDIUUXBOZSDR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|