C29H27Cl2N3O2S — CID 141362409
4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 141362409) has the molecular formula C29H27Cl2N3O2S and a molecular weight of 552.53 g/mol. Its IUPAC name is 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 141362409 |
| Molecular Formula | C29H27Cl2N3O2S |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 4-[4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2)cc1 |
| InChI | InChI=1S/C29H27Cl2N3O2S/c30-25-11-10-24(18-26(25)31)27-19-37-29(33-27)23-8-4-21(5-9-23)20-2-6-22(7-3-20)28(35)32-12-1-13-34-14-16-36-17-15-34/h2-11,18-19H,1,12-17H2,(H,32,35) |
| InChIKey | OXNKBDXRANKJAW-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|