C27H28N4O2 — CID 42691502
N-(3-morpholin-4-ylpropyl)-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 42691502) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 42691502 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(-c2cc(-c3cccc4ccccc34)[nH]n2)cc1 |
| InChI | InChI=1S/C27H28N4O2/c32-27(28-13-4-14-31-15-17-33-18-16-31)22-11-9-21(10-12-22)25-19-26(30-29-25)24-8-3-6-20-5-1-2-7-23(20)24/h1-3,5-12,19H,4,13-18H2,(H,28,32)(H,29,30) |
| InChIKey | ZOPBYTIJWXTEBF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|