C21H23N3O3 — CID 67424998
N-(3-morpholin-4-ylpropyl)-6-oxo-5H-phenanthridine-3-carboxamide (PubChem CID 67424998) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-6-oxo-5H-phenanthridine-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-6-oxo-5H-phenanthridine-3-carboxamide |
|---|---|
| PubChem CID | 67424998 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-6-oxo-5H-phenanthridine-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc2c(c1)[nH]c(=O)c1ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c25-20(22-8-3-9-24-10-12-27-13-11-24)15-6-7-17-16-4-1-2-5-18(16)21(26)23-19(17)14-15/h1-2,4-7,14H,3,8-13H2,(H,22,25)(H,23,26) |
| InChIKey | GLGVWOFFSZVCOD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|