C21H25N3O7 — CID 51057245
(Z)-but-2-enedioic acid;N-(3-morpholin-4-ylpropyl)-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 51057245) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-(3-morpholin-4-ylpropyl)-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;N-(3-morpholin-4-ylpropyl)-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 51057245 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-(3-morpholin-4-ylpropyl)-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(=O)c2ccccc2[nH]1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H21N3O3.C4H4O4/c21-16-12-15(19-14-5-2-1-4-13(14)16)17(22)18-6-3-7-20-8-10-23-11-9-20;5-3(6)1-2-4(7)8/h1-2,4-5,12H,3,6-11H2,(H,18,22)(H,19,21);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DHBPHIDNABFNLE-BTJKTKAUSA-N |
| XLogP | 0.69 |
| TPSA | 149.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|