C19H26FN3O6S — CID 163332628
6-fluoro-N-(4-morpholin-4-ylbutyl)-4-oxo-1H-quinoline-2-carboxamide;methanesulfonic acid (PubChem CID 163332628) has the molecular formula C19H26FN3O6S and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-fluoro-N-(4-morpholin-4-ylbutyl)-4-oxo-1H-quinoline-2-carboxamide;methanesulfonic acid.
| Compound Name | 6-fluoro-N-(4-morpholin-4-ylbutyl)-4-oxo-1H-quinoline-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 163332628 |
| Molecular Formula | C19H26FN3O6S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-fluoro-N-(4-morpholin-4-ylbutyl)-4-oxo-1H-quinoline-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(NCCCCN1CCOCC1)c1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C18H22FN3O3.CH4O3S/c19-13-3-4-15-14(11-13)17(23)12-16(21-15)18(24)20-5-1-2-6-22-7-9-25-10-8-22;1-5(2,3)4/h3-4,11-12H,1-2,5-10H2,(H,20,24)(H,21,23);1H3,(H,2,3,4) |
| InChIKey | LDYDHHLUYGUSBH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|