C21H22N4O4 — CID 22109781
N-(2-morpholin-4-ylethyl)-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide (PubChem CID 22109781) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 22109781 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2,4-dioxo-3-phenyl-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc2c(=O)n(-c3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H22N4O4/c26-19(22-8-9-24-10-12-29-13-11-24)15-6-7-17-18(14-15)23-21(28)25(20(17)27)16-4-2-1-3-5-16/h1-7,14H,8-13H2,(H,22,26)(H,23,28) |
| InChIKey | ROMUEBMKDDRGQT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |