C24H27N5O2 — CID 50783731
N-(3-morpholin-4-ylpropyl)-3-[(6-phenylpyrimidin-4-yl)amino]benzamide (PubChem CID 50783731) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-3-[(6-phenylpyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-3-[(6-phenylpyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 50783731 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-3-[(6-phenylpyrimidin-4-yl)amino]benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cccc(Nc2cc(-c3ccccc3)ncn2)c1 |
| InChI | InChI=1S/C24H27N5O2/c30-24(25-10-5-11-29-12-14-31-15-13-29)20-8-4-9-21(16-20)28-23-17-22(26-18-27-23)19-6-2-1-3-7-19/h1-4,6-9,16-18H,5,10-15H2,(H,25,30)(H,26,27,28) |
| InChIKey | YGLGDLLJYZSHKO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|