C25H30N6O — CID 46416964
N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(pyrimidin-2-ylamino)benzamide (PubChem CID 46416964) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(pyrimidin-2-ylamino)benzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(pyrimidin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 46416964 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-3-(pyrimidin-2-ylamino)benzamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1cccc(Nc2ncccn2)c1 |
| InChI | InChI=1S/C25H30N6O/c32-24(22-9-4-10-23(19-22)29-25-27-11-5-12-28-25)26-13-6-14-30-15-17-31(18-16-30)20-21-7-2-1-3-8-21/h1-5,7-12,19H,6,13-18,20H2,(H,26,32)(H,27,28,29) |
| InChIKey | TXEGXAZCSCPFHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|