C24H28N6O2S — CID 46353979
5-N-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-phenyl-1,3,4-thiadiazole-2,5-dicarboxamide (PubChem CID 46353979) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 5-N-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-phenyl-1,3,4-thiadiazole-2,5-dicarboxamide.
| Compound Name | 5-N-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-phenyl-1,3,4-thiadiazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 46353979 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5-N-[3-(4-benzylpiperazin-1-yl)propyl]-2-N-phenyl-1,3,4-thiadiazole-2,5-dicarboxamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1nnc(C(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C24H28N6O2S/c31-21(23-27-28-24(33-23)22(32)26-20-10-5-2-6-11-20)25-12-7-13-29-14-16-30(17-15-29)18-19-8-3-1-4-9-19/h1-6,8-11H,7,12-18H2,(H,25,31)(H,26,32) |
| InChIKey | FTMMXGIJINDQSQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|