C22H32N6O2S — CID 46354535
5-[3-oxo-3-[3-(4-propylpiperazin-1-yl)propylamino]propyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46354535) has the molecular formula C22H32N6O2S and a molecular weight of 444.61 g/mol. Its IUPAC name is 5-[3-oxo-3-[3-(4-propylpiperazin-1-yl)propylamino]propyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[3-oxo-3-[3-(4-propylpiperazin-1-yl)propylamino]propyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46354535 |
| Molecular Formula | C22H32N6O2S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 5-[3-oxo-3-[3-(4-propylpiperazin-1-yl)propylamino]propyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCN1CCN(CCCNC(=O)CCc2nnc(C(=O)Nc3ccccc3)s2)CC1 |
| InChI | InChI=1S/C22H32N6O2S/c1-2-12-27-14-16-28(17-15-27)13-6-11-23-19(29)9-10-20-25-26-22(31-20)21(30)24-18-7-4-3-5-8-18/h3-5,7-8H,2,6,9-17H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | YGINLYUMJGDUOB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|