C19H25N5O4S — CID 46319982
5-[[2-(3-morpholin-4-ylpropylamino)-2-oxoethoxy]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46319982) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is 5-[[2-(3-morpholin-4-ylpropylamino)-2-oxoethoxy]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[[2-(3-morpholin-4-ylpropylamino)-2-oxoethoxy]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46319982 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-[[2-(3-morpholin-4-ylpropylamino)-2-oxoethoxy]methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(COCc1nnc(C(=O)Nc2ccccc2)s1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H25N5O4S/c25-16(20-7-4-8-24-9-11-27-12-10-24)13-28-14-17-22-23-19(29-17)18(26)21-15-5-2-1-3-6-15/h1-3,5-6H,4,7-14H2,(H,20,25)(H,21,26) |
| InChIKey | ZIMCRCGUSXMFLN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|