C23H34N6O2S — CID 46320195
5-[4-[3-(4-ethylpiperazin-1-yl)propylamino]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 46320195) has the molecular formula C23H34N6O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is 5-[4-[3-(4-ethylpiperazin-1-yl)propylamino]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[4-[3-(4-ethylpiperazin-1-yl)propylamino]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 46320195 |
| Molecular Formula | C23H34N6O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 5-[4-[3-(4-ethylpiperazin-1-yl)propylamino]-4-oxobutyl]-N-(4-methylphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)CCCc2nnc(C(=O)Nc3ccc(C)cc3)s2)CC1 |
| InChI | InChI=1S/C23H34N6O2S/c1-3-28-14-16-29(17-15-28)13-5-12-24-20(30)6-4-7-21-26-27-23(32-21)22(31)25-19-10-8-18(2)9-11-19/h8-11H,3-7,12-17H2,1-2H3,(H,24,30)(H,25,31) |
| InChIKey | NQBPYPOIXDDHFR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|