C30H33N5O — CID 58958075
N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-[(2-methylquinolin-4-yl)amino]benzamide (PubChem CID 58958075) has the molecular formula C30H33N5O and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-[(2-methylquinolin-4-yl)amino]benzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-[(2-methylquinolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 58958075 |
| Molecular Formula | C30H33N5O |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-[(2-methylquinolin-4-yl)amino]benzamide |
| SMILES | Cc1cc(Nc2cccc(C(=O)NCCN3CCN(Cc4ccccc4)CC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C30H33N5O/c1-23-20-29(27-12-5-6-13-28(27)32-23)33-26-11-7-10-25(21-26)30(36)31-14-15-34-16-18-35(19-17-34)22-24-8-3-2-4-9-24/h2-13,20-21H,14-19,22H2,1H3,(H,31,36)(H,32,33) |
| InChIKey | FQYYAPXWQWLCKD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |