C26H29N7O — CID 53067547
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide (PubChem CID 53067547) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53067547 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1ccc(-n2nnc3cccnc32)cc1 |
| InChI | InChI=1S/C26H29N7O/c34-26(22-9-11-23(12-10-22)33-25-24(29-30-33)8-4-13-27-25)28-14-5-15-31-16-18-32(19-17-31)20-21-6-2-1-3-7-21/h1-4,6-13H,5,14-20H2,(H,28,34) |
| InChIKey | VHMZTWPWTVDFNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|