C24H28ClN5O — CID 55852638
N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide (PubChem CID 55852638) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55852638 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)c1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H28ClN5O/c25-22-7-9-23(10-8-22)30-19-21(17-27-30)24(31)26-11-4-12-28-13-15-29(16-14-28)18-20-5-2-1-3-6-20/h1-3,5-10,17,19H,4,11-16,18H2,(H,26,31) |
| InChIKey | OTZPYWDNJPDYSO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|