C26H29N7O2 — CID 53069744
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(triazolo[4,5-b]pyridin-3-yl)benzamide (PubChem CID 53069744) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(triazolo[4,5-b]pyridin-3-yl)benzamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(triazolo[4,5-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53069744 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(triazolo[4,5-b]pyridin-3-yl)benzamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3cccc(-n4nnc5cccnc54)c3)CC2)cc1 |
| InChI | InChI=1S/C26H29N7O2/c1-35-23-10-8-21(9-11-23)32-17-15-31(16-18-32)14-4-13-28-26(34)20-5-2-6-22(19-20)33-25-24(29-30-33)7-3-12-27-25/h2-3,5-12,19H,4,13-18H2,1H3,(H,28,34) |
| InChIKey | SZVRNWIJZFAQHX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|