C24H25N5O3 — CID 53006218
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide (PubChem CID 53006218) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53006218 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(-n3nnc4cccnc43)cc2)cc1OCC |
| InChI | InChI=1S/C24H25N5O3/c1-3-31-21-12-7-17(16-22(21)32-4-2)13-15-26-24(30)18-8-10-19(11-9-18)29-23-20(27-28-29)6-5-14-25-23/h5-12,14,16H,3-4,13,15H2,1-2H3,(H,26,30) |
| InChIKey | NOMZASXDMYHRDW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |