C22H24BrN3O3 — CID 50772666
1-(4-bromophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]pyrazole-4-carboxamide (PubChem CID 50772666) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 50772666 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 1-(4-bromophenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]pyrazole-4-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cnn(-c3ccc(Br)cc3)c2)cc1OCC |
| InChI | InChI=1S/C22H24BrN3O3/c1-3-28-20-10-5-16(13-21(20)29-4-2)11-12-24-22(27)17-14-25-26(15-17)19-8-6-18(23)7-9-19/h5-10,13-15H,3-4,11-12H2,1-2H3,(H,24,27) |
| InChIKey | QEFLKVOAXHRVJJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |