C27H34N6O — CID 50783692
3-[[6-(4-methylphenyl)pyrimidin-4-yl]amino]-N-[2-(4-propylpiperazin-1-yl)ethyl]benzamide (PubChem CID 50783692) has the molecular formula C27H34N6O and a molecular weight of 458.61 g/mol. Its IUPAC name is 3-[[6-(4-methylphenyl)pyrimidin-4-yl]amino]-N-[2-(4-propylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 3-[[6-(4-methylphenyl)pyrimidin-4-yl]amino]-N-[2-(4-propylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 50783692 |
| Molecular Formula | C27H34N6O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 3-[[6-(4-methylphenyl)pyrimidin-4-yl]amino]-N-[2-(4-propylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CCCN1CCN(CCNC(=O)c2cccc(Nc3cc(-c4ccc(C)cc4)ncn3)c2)CC1 |
| InChI | InChI=1S/C27H34N6O/c1-3-12-32-14-16-33(17-15-32)13-11-28-27(34)23-5-4-6-24(18-23)31-26-19-25(29-20-30-26)22-9-7-21(2)8-10-22/h4-10,18-20H,3,11-17H2,1-2H3,(H,28,34)(H,29,30,31) |
| InChIKey | YXTOUKBTFUSCFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |