C25H29FN6O — CID 50783465
N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-[[6-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 50783465) has the molecular formula C25H29FN6O and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-[[6-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-[[6-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 50783465 |
| Molecular Formula | C25H29FN6O |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-4-[[6-(3-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | CCN1CCN(CCNC(=O)c2ccc(Nc3cc(-c4cccc(F)c4)ncn3)cc2)CC1 |
| InChI | InChI=1S/C25H29FN6O/c1-2-31-12-14-32(15-13-31)11-10-27-25(33)19-6-8-22(9-7-19)30-24-17-23(28-18-29-24)20-4-3-5-21(26)16-20/h3-9,16-18H,2,10-15H2,1H3,(H,27,33)(H,28,29,30) |
| InChIKey | WJUYMTIGJPKWRV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |