C21H20N4O — CID 50783560
[3-[(6-phenylpyrimidin-4-yl)amino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 50783560) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is [3-[(6-phenylpyrimidin-4-yl)amino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[(6-phenylpyrimidin-4-yl)amino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 50783560 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [3-[(6-phenylpyrimidin-4-yl)amino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cccc(Nc2cc(-c3ccccc3)ncn2)c1)N1CCCC1 |
| InChI | InChI=1S/C21H20N4O/c26-21(25-11-4-5-12-25)17-9-6-10-18(13-17)24-20-14-19(22-15-23-20)16-7-2-1-3-8-16/h1-3,6-10,13-15H,4-5,11-12H2,(H,22,23,24) |
| InChIKey | BJJAUBZVWAKILO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |