C24H28N4O — CID 46327059
3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N,N-dipropylbenzamide (PubChem CID 46327059) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 46327059 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(Nc2cc(-c3cccc(C)c3)ncn2)c1 |
| InChI | InChI=1S/C24H28N4O/c1-4-12-28(13-5-2)24(29)20-10-7-11-21(15-20)27-23-16-22(25-17-26-23)19-9-6-8-18(3)14-19/h6-11,14-17H,4-5,12-13H2,1-3H3,(H,25,26,27) |
| InChIKey | JRCNWFGKVZRHGP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |