C28H28N4O — CID 92870064
3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N-[(2R)-4-phenylbutan-2-yl]benzamide (PubChem CID 92870064) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N-[(2R)-4-phenylbutan-2-yl]benzamide.
| Compound Name | 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 92870064 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 3-[[6-(3-methylphenyl)pyrimidin-4-yl]amino]-N-[(2R)-4-phenylbutan-2-yl]benzamide |
| SMILES | Cc1cccc(-c2cc(Nc3cccc(C(=O)N[C@H](C)CCc4ccccc4)c3)ncn2)c1 |
| InChI | InChI=1S/C28H28N4O/c1-20-8-6-11-23(16-20)26-18-27(30-19-29-26)32-25-13-7-12-24(17-25)28(33)31-21(2)14-15-22-9-4-3-5-10-22/h3-13,16-19,21H,14-15H2,1-2H3,(H,31,33)(H,29,30,32)/t21-/m1/s1 |
| InChIKey | MZOYZGHFHLWGKT-OAQYLSRUSA-N |
| XLogP | 5.95 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |