C29H28FN5O — CID 50783567
N-(1-benzylpiperidin-4-yl)-3-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 50783567) has the molecular formula C29H28FN5O and a molecular weight of 481.58 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 50783567 |
| Molecular Formula | C29H28FN5O |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cccc(Nc2cc(-c3ccc(F)cc3)ncn2)c1 |
| InChI | InChI=1S/C29H28FN5O/c30-24-11-9-22(10-12-24)27-18-28(32-20-31-27)33-26-8-4-7-23(17-26)29(36)34-25-13-15-35(16-14-25)19-21-5-2-1-3-6-21/h1-12,17-18,20,25H,13-16,19H2,(H,34,36)(H,31,32,33) |
| InChIKey | KHMOTMJIBLNHJM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |