C21H33N5O4 — CID 4595283
2-N,5-N-bis(3-morpholin-4-ylpropyl)pyridine-2,5-dicarboxamide (PubChem CID 4595283) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-N,5-N-bis(3-morpholin-4-ylpropyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(3-morpholin-4-ylpropyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4595283 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 2-N,5-N-bis(3-morpholin-4-ylpropyl)pyridine-2,5-dicarboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(C(=O)NCCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C21H33N5O4/c27-20(22-5-1-7-25-9-13-29-14-10-25)18-3-4-19(24-17-18)21(28)23-6-2-8-26-11-15-30-16-12-26/h3-4,17H,1-2,5-16H2,(H,22,27)(H,23,28) |
| InChIKey | KKJICFRTLBDEIH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|