C17H29N5O2 — CID 109153978
N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridine-3-carboxamide (PubChem CID 109153978) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109153978 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(NCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C17H29N5O2/c1-21(2)8-3-6-19-17(23)15-4-5-16(20-14-15)18-7-9-22-10-12-24-13-11-22/h4-5,14H,3,6-13H2,1-2H3,(H,18,20)(H,19,23) |
| InChIKey | ZTHGMKOILFOVGI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|