C16H28N6O2 — CID 109115508
N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide (PubChem CID 109115508) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109115508 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(NCCN2CCOCC2)nn1 |
| InChI | InChI=1S/C16H28N6O2/c1-21(2)8-3-6-18-16(23)14-4-5-15(20-19-14)17-7-9-22-10-12-24-13-11-22/h4-5H,3,6-13H2,1-2H3,(H,17,20)(H,18,23) |
| InChIKey | PZSSSIJONKSGEV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|