C15H26N6O2 — CID 109115327
N-[2-(dimethylamino)ethyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide (PubChem CID 109115327) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109115327 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-(2-morpholin-4-ylethylamino)pyridazine-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc(NCCN2CCOCC2)nn1 |
| InChI | InChI=1S/C15H26N6O2/c1-20(2)7-5-17-15(22)13-3-4-14(19-18-13)16-6-8-21-9-11-23-12-10-21/h3-4H,5-12H2,1-2H3,(H,16,19)(H,17,22) |
| InChIKey | CAKGDUACRWEHJV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |