C10H12Cl2N2O — CID 170431852
(NE)-N-[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethylidene]hydroxylamine (PubChem CID 170431852) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is (NE)-N-[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 170431852 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (NE)-N-[1-(3,4-dichlorophenyl)-2-(dimethylamino)ethylidene]hydroxylamine |
| SMILES | CN(C)C/C(=N/O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O/c1-14(2)6-10(13-15)7-3-4-8(11)9(12)5-7/h3-5,15H,6H2,1-2H3/b13-10- |
| InChIKey | VYMFKXZEPGDWPW-RAXLEYEMSA-N |
| XLogP | 2.73 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|