C12H15Cl2N3O2 — CID 90975974
4-(3,4-dichlorophenyl)-N'-hydroxy-4-(methoxymethylimino)butanimidamide (PubChem CID 90975974) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N'-hydroxy-4-(methoxymethylimino)butanimidamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N'-hydroxy-4-(methoxymethylimino)butanimidamide |
|---|---|
| PubChem CID | 90975974 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N'-hydroxy-4-(methoxymethylimino)butanimidamide |
| SMILES | COCN=C(CCC(N)=NO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c1-19-7-16-11(4-5-12(15)17-18)8-2-3-9(13)10(14)6-8/h2-3,6,18H,4-5,7H2,1H3,(H2,15,17) |
| InChIKey | DCBPAPKSGXLNNC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|