C14H20Cl2N2O3 — CID 88810610
2-[[1-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)propylidene]amino]oxyethanamine (PubChem CID 88810610) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-[[1-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)propylidene]amino]oxyethanamine.
| Compound Name | 2-[[1-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)propylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 88810610 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[[1-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)propylidene]amino]oxyethanamine |
| SMILES | COCCOCCC(=NOCCN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O3/c1-19-8-9-20-6-4-14(18-21-7-5-17)11-2-3-12(15)13(16)10-11/h2-3,10H,4-9,17H2,1H3 |
| InChIKey | IMLPNFRANGWOFQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|