C15H19Cl2N3O — CID 88810855
7-(2-aminoethoxyimino)-7-(3,4-dichlorophenyl)heptanenitrile (PubChem CID 88810855) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is 7-(2-aminoethoxyimino)-7-(3,4-dichlorophenyl)heptanenitrile.
| Compound Name | 7-(2-aminoethoxyimino)-7-(3,4-dichlorophenyl)heptanenitrile |
|---|---|
| PubChem CID | 88810855 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 7-(2-aminoethoxyimino)-7-(3,4-dichlorophenyl)heptanenitrile |
| SMILES | N#CCCCCCC(=NOCCN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O/c16-13-7-6-12(11-14(13)17)15(20-21-10-9-19)5-3-1-2-4-8-18/h6-7,11H,1-5,9-10,19H2 |
| InChIKey | UBSWPWURGPTDOV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|