C19H25N3O6S — CID 159551800
6-(2-aminoethoxyimino)-6-(4-methylsulfinylphenyl)hexanenitrile;(E)-but-2-enedioic acid (PubChem CID 159551800) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 6-(2-aminoethoxyimino)-6-(4-methylsulfinylphenyl)hexanenitrile;(E)-but-2-enedioic acid.
| Compound Name | 6-(2-aminoethoxyimino)-6-(4-methylsulfinylphenyl)hexanenitrile;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 159551800 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 6-(2-aminoethoxyimino)-6-(4-methylsulfinylphenyl)hexanenitrile;(E)-but-2-enedioic acid |
| SMILES | CS(=O)c1ccc(C(CCCCC#N)=NOCCN)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H21N3O2S.C4H4O4/c1-21(19)14-8-6-13(7-9-14)15(18-20-12-11-17)5-3-2-4-10-16;5-3(6)1-2-4(7)8/h6-9H,2-5,11-12,17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MFMIHPVIHVKKLK-WLHGVMLRSA-N |
| XLogP | 1.90 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|