C14H21ClN2O2S — CID 154348891
2-[[5-chloro-1-(4-methylsulfinylphenyl)pentylidene]amino]oxyethanamine (PubChem CID 154348891) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 2-[[5-chloro-1-(4-methylsulfinylphenyl)pentylidene]amino]oxyethanamine.
| Compound Name | 2-[[5-chloro-1-(4-methylsulfinylphenyl)pentylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 154348891 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[[5-chloro-1-(4-methylsulfinylphenyl)pentylidene]amino]oxyethanamine |
| SMILES | CS(=O)c1ccc(C(CCCCCl)=NOCCN)cc1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-20(18)13-7-5-12(6-8-13)14(4-2-3-9-15)17-19-11-10-16/h5-8H,2-4,9-11,16H2,1H3 |
| InChIKey | GUYIQOJCVNSDRF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|