C20H29BrN2O7 — CID 173452318
2-[[1-(4-bromophenyl)-5-(2-methoxyethoxy)pentylidene]amino]oxyethanamine;but-2-enedioic acid (PubChem CID 173452318) has the molecular formula C20H29BrN2O7 and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-[[1-(4-bromophenyl)-5-(2-methoxyethoxy)pentylidene]amino]oxyethanamine;but-2-enedioic acid.
| Compound Name | 2-[[1-(4-bromophenyl)-5-(2-methoxyethoxy)pentylidene]amino]oxyethanamine;but-2-enedioic acid |
|---|---|
| PubChem CID | 173452318 |
| Molecular Formula | C20H29BrN2O7 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[[1-(4-bromophenyl)-5-(2-methoxyethoxy)pentylidene]amino]oxyethanamine;but-2-enedioic acid |
| SMILES | COCCOCCCCC(=NOCCN)c1ccc(Br)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H25BrN2O3.C4H4O4/c1-20-12-13-21-10-3-2-4-16(19-22-11-9-18)14-5-7-15(17)8-6-14;5-3(6)1-2-4(7)8/h5-8H,2-4,9-13,18H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RDEUFCLHXPTGRL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|