C15H21Cl2FN4O — CID 19078329
2-[(E)-[1-(4-fluorophenyl)-4-imidazol-1-ylbutylidene]amino]oxyethanamine;dihydrochloride (PubChem CID 19078329) has the molecular formula C15H21Cl2FN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is 2-[(E)-[1-(4-fluorophenyl)-4-imidazol-1-ylbutylidene]amino]oxyethanamine;dihydrochloride.
| Compound Name | 2-[(E)-[1-(4-fluorophenyl)-4-imidazol-1-ylbutylidene]amino]oxyethanamine;dihydrochloride |
|---|---|
| PubChem CID | 19078329 |
| Molecular Formula | C15H21Cl2FN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[(E)-[1-(4-fluorophenyl)-4-imidazol-1-ylbutylidene]amino]oxyethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCO/N=C(\CCCn1ccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN4O.2ClH/c16-14-5-3-13(4-6-14)15(19-21-11-7-17)2-1-9-20-10-8-18-12-20;;/h3-6,8,10,12H,1-2,7,9,11,17H2;2*1H/b19-15+;; |
| InChIKey | TVNFDMOIDICFGH-WTBAQZMLSA-N |
| XLogP | 3.03 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|