C19H24F3N4OS+ — CID 162540663
3-imidazol-1-yl-N-(2-thiomorpholin-1-ium-1-ylethoxy)-1-[4-(trifluoromethyl)phenyl]propan-1-imine (PubChem CID 162540663) has the molecular formula C19H24F3N4OS+ and a molecular weight of 413.49 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(2-thiomorpholin-1-ium-1-ylethoxy)-1-[4-(trifluoromethyl)phenyl]propan-1-imine.
| Compound Name | 3-imidazol-1-yl-N-(2-thiomorpholin-1-ium-1-ylethoxy)-1-[4-(trifluoromethyl)phenyl]propan-1-imine |
|---|---|
| PubChem CID | 162540663 |
| Molecular Formula | C19H24F3N4OS+ |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-imidazol-1-yl-N-(2-thiomorpholin-1-ium-1-ylethoxy)-1-[4-(trifluoromethyl)phenyl]propan-1-imine |
| SMILES | FC(F)(F)c1ccc(C(CCn2ccnc2)=NOCC[S+]2CCNCC2)cc1 |
| InChI | InChI=1S/C19H24F3N4OS/c20-19(21,22)17-3-1-16(2-4-17)18(5-9-26-10-6-24-15-26)25-27-11-14-28-12-7-23-8-13-28/h1-4,6,10,15,23H,5,7-9,11-14H2/q+1 |
| InChIKey | JCNZEHSPLNWDIF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|