C16H21Cl2F3N4O — CID 73474165
2-[[4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butylidene]amino]oxyethanamine;dihydrochloride (PubChem CID 73474165) has the molecular formula C16H21Cl2F3N4O and a molecular weight of 413.27 g/mol. Its IUPAC name is 2-[[4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butylidene]amino]oxyethanamine;dihydrochloride.
| Compound Name | 2-[[4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butylidene]amino]oxyethanamine;dihydrochloride |
|---|---|
| PubChem CID | 73474165 |
| Molecular Formula | C16H21Cl2F3N4O |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[[4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butylidene]amino]oxyethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCON=C(CCCn1ccnc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N4O.2ClH/c17-16(18,19)14-5-3-13(4-6-14)15(22-24-11-7-20)2-1-9-23-10-8-21-12-23;;/h3-6,8,10,12H,1-2,7,9,11,20H2;2*1H |
| InChIKey | PRHGWNDTAMQPTK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|