C14H13F3N2O — CID 19078351
4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butan-1-one (PubChem CID 19078351) has the molecular formula C14H13F3N2O and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butan-1-one.
| Compound Name | 4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 19078351 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-imidazol-1-yl-1-[4-(trifluoromethyl)phenyl]butan-1-one |
| SMILES | O=C(CCCn1ccnc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)12-5-3-11(4-6-12)13(20)2-1-8-19-9-7-18-10-19/h3-7,9-10H,1-2,8H2 |
| InChIKey | PKSSAPVOUQKKJJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |