C30H28N4O — CID 148658685
1-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-5-imidazol-1-ylpentan-1-one (PubChem CID 148658685) has the molecular formula C30H28N4O and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-5-imidazol-1-ylpentan-1-one.
| Compound Name | 1-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-5-imidazol-1-ylpentan-1-one |
|---|---|
| PubChem CID | 148658685 |
| Molecular Formula | C30H28N4O |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-5-imidazol-1-ylpentan-1-one |
| SMILES | Cc1ccc(-c2nc3ccc(C(=O)CCCCn4ccnc4)cc3nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H28N4O/c1-21-6-10-23(11-7-21)29-30(24-12-8-22(2)9-13-24)33-27-19-25(14-15-26(27)32-29)28(35)5-3-4-17-34-18-16-31-20-34/h6-16,18-20H,3-5,17H2,1-2H3 |
| InChIKey | NNIRIIISWKKATI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|