C34H33N5O2 — CID 160827657
5-imidazol-1-yl-1-(3-phenyl-2-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylquinoxalin-6-yl)pentan-1-one (PubChem CID 160827657) has the molecular formula C34H33N5O2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 5-imidazol-1-yl-1-(3-phenyl-2-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylquinoxalin-6-yl)pentan-1-one.
| Compound Name | 5-imidazol-1-yl-1-(3-phenyl-2-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylquinoxalin-6-yl)pentan-1-one |
|---|---|
| PubChem CID | 160827657 |
| Molecular Formula | C34H33N5O2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 5-imidazol-1-yl-1-(3-phenyl-2-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylquinoxalin-6-yl)pentan-1-one |
| SMILES | O=C(CCCCn1ccnc1)c1ccc2nc(N3CCC4(CC3)Cc3ccccc3O4)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C34H33N5O2/c40-30(11-6-7-18-38-21-17-35-24-38)26-13-14-28-29(22-26)36-32(25-8-2-1-3-9-25)33(37-28)39-19-15-34(16-20-39)23-27-10-4-5-12-31(27)41-34/h1-5,8-10,12-14,17,21-22,24H,6-7,11,15-16,18-20,23H2 |
| InChIKey | SGJWVBZKTWRZQX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|