C25H26N6O — CID 118463952
2-(cyclobutylamino)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide (PubChem CID 118463952) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(cyclobutylamino)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide.
| Compound Name | 2-(cyclobutylamino)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463952 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-(cyclobutylamino)-N-(3-imidazol-1-ylpropyl)-3-phenylquinoxaline-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2nc(NC3CCC3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C25H26N6O/c32-25(27-12-5-14-31-15-13-26-17-31)19-10-11-21-22(16-19)29-23(18-6-2-1-3-7-18)24(30-21)28-20-8-4-9-20/h1-3,6-7,10-11,13,15-17,20H,4-5,8-9,12,14H2,(H,27,32)(H,28,30) |
| InChIKey | MRFURHFXVRVPNA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|