C27H28N6O — CID 118463507
N-(3-imidazol-1-ylpropyl)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-phenylquinoxaline-6-carboxamide (PubChem CID 118463507) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-phenylquinoxaline-6-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-phenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463507 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-2-phenylquinoxaline-6-carboxamide |
| SMILES | CN1CC=C(c2nc3cc(C(=O)NCCCn4ccnc4)ccc3nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28N6O/c1-32-15-10-21(11-16-32)26-25(20-6-3-2-4-7-20)30-23-9-8-22(18-24(23)31-26)27(34)29-12-5-14-33-17-13-28-19-33/h2-4,6-10,13,17-19H,5,11-12,14-16H2,1H3,(H,29,34) |
| InChIKey | ZIJROHSYZKMSDT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|